CymitQuimica logo

CAS 89889-52-1

:

Biotin-Xx-Nhs

Description:
Biotin-Xx-Nhs, with the CAS number 89889-52-1, is a chemical compound that serves as a biotinylation reagent, commonly used in biochemical applications to label proteins, peptides, or other biomolecules with biotin. This compound features a biotin moiety, which is a vitamin that plays a crucial role in cellular metabolism, and an N-hydroxysuccinimide (NHS) ester, which facilitates the formation of stable amide bonds with primary amines present in target molecules. The NHS ester is particularly useful for conjugation reactions because it reacts efficiently under mild conditions, allowing for selective labeling without significantly altering the biological activity of the target. Biotin-Xx-Nhs is often employed in various applications, including affinity purification, detection assays, and in the development of biotin-streptavidin systems, which are widely utilized in molecular biology and biochemistry. The compound is typically stored under appropriate conditions to maintain its stability and reactivity.
Formula:C26H41N5O7S
InChI:InChI=1S/C26H41N5O7S/c32-20(27-16-8-2-4-12-24(36)38-31-22(34)13-14-23(31)35)10-3-1-7-15-28-21(33)11-6-5-9-19-25-18(17-39-19)29-26(37)30-25/h18-19,25H,1-17H2,(H,27,32)(H,28,33)(H2,29,30,37)/t18-,19-,25-/m0/s1
InChI key:ATYCFNRXENKXSE-MHPIHPPYSA-N
SMILES:C1CC(=O)N(C1=O)OC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3
Found 7 products.