CymitQuimica logo

CAS 89909-51-3

:

1H-Pyrrole-2-carboxaldehyde,4-bromo-3,5-dimethyl-

Description:
1H-Pyrrole-2-carboxaldehyde, 4-bromo-3,5-dimethyl- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxaldehyde functional group (-CHO) at the 2-position of the pyrrole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of bromine at the 4-position and two methyl groups at the 3 and 5 positions enhances its chemical properties, influencing its reactivity and solubility. The bromine substituent can participate in electrophilic aromatic substitution reactions, while the methyl groups can affect steric hindrance and electronic properties. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features. Additionally, its CAS number, 89909-51-3, serves as a unique identifier for regulatory and safety information. As with many organic compounds, handling should be done with care, considering potential hazards associated with its chemical structure.
Formula:C7H8BrNO
InChI:InChI=1S/C7H8BrNO/c1-4-6(3-10)9-5(2)7(4)8/h3,9H,1-2H3
InChI key:MZWOWXCHTRXTRI-UHFFFAOYSA-N
SMILES:CC1=C(NC(=C1Br)C)C=O
Synonyms:
  • 4-Bromo-3,5-dimethyl-1H-pyrrole-2-carboxaldehyde
  • 4-Bromo-3,5-dimethylpyrrole-2-carboxaldehyde
Found 5 products.