CymitQuimica logo

CAS 89941-55-9

:

methyl 3-(hydroxymethyl)cyclobutanecarboxylate

Description:
Methyl 3-(hydroxymethyl)cyclobutanecarboxylate, with the CAS number 89941-55-9, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. This compound features a carboxylate functional group and a hydroxymethyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Methyl 3-(hydroxymethyl)cyclobutanecarboxylate may exhibit interesting properties such as chirality, depending on the configuration of its substituents, which can influence its biological activity and interactions. Its structural features suggest potential utility in the development of pharmaceuticals or agrochemicals, as compounds with cyclobutane rings often exhibit unique biological properties. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for detailed applications and handling guidelines.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-10-7(9)6-2-5(3-6)4-8/h5-6,8H,2-4H2,1H3
InChI key:LQUXXSRNBCFGDV-UHFFFAOYSA-N
SMILES:COC(=O)C1CC(C1)CO
Found 3 products.