CAS 899548-78-8

Formula: C16H11N3O2

InChI: InChI=1S/C16H11N3O2/c1-9-2-3-14-10(6-9)7-11(16(20)21-14)15-18-12-4-5-17-8-13(12)19-15/h2-8H,1H3,(H,18,19)

InChI key: AFTXOIIKGOXDOT-UHFFFAOYSA-N

SMILES: CC1=CC2=C(C=C1)OC(=O)C(=C2)C3=NC4=C(N3)C=NC=C4

JMJD6 inhibitor WL12

CAS: 899548-78-8

WL12 (ZINC6733033): First-in-class JMJD6 inhibitor; halts JMJD6-dependent cervical/liver cancer cell growth.

Formula: C₁₆H₁₁N₃O₂

Purity: 99.63%

Color and Shape: Yellow Solid

Molecular weight: 277.28

Ref: TM-T9939

3-(3H-Imidazo[4,5-c]pyridin-2-yl)-6-methyl-2H-chromen-2-one

CAS: 899548-78-8

Formula: C₁₆H₁₁N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 277.2774

Ref: IN-DA0201LQ

JMJD6 inhibitor WL12

CAS: 899548-78-8

JMJD6 inhibitor WL12

Formula: C₁₆H₁₁N₃O₂

Purity: ≥98%

Molecular weight: 277.28

Ref: 54-BUP08372

3-(3H-Imidazo[4,5-c]pyridin-2-yl)-6-methyl-2H-chromen-2-one

CAS: 899548-78-8

Purity: 98%

Molecular weight: 277.2829895

Ref: 10-F868030

3-(1H-Imidazo[4,5-c]pyridin-2-yl)-6-methyl-2H-chromen-2-one

CAS: 899548-78-8

3-(1H-Imidazo[4,5-c]pyridin-2-yl)-6-methyl-2H-chromen-2-one is a heterocyclic compound used in biochemical research, which is synthesized through methods involving complex organic reactions typically in a laboratory setting. This compound functions as an investigational agent that may interact with specific molecular targets such as enzymes or receptors. Its unique structural attributes allow it to engage in specific binding interactions, potentially modulating biological pathways that are relevant in disease contexts.

Formula: C₁₆H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 277.28 g/mol

Ref: 3D-ZKB54878