CAS 90-49-3: Pheneturide
Description:Pheneturide, with the CAS number 90-49-3, is a chemical compound that belongs to the class of organic compounds known as amides. It is characterized by its structure, which includes a phenyl group attached to an ethyl group and an amide functional group. This compound is typically a white to off-white crystalline solid and is known for its use in medicinal chemistry, particularly as an anticonvulsant agent. Pheneturide exhibits moderate solubility in water and is more soluble in organic solvents, which is common for many amides. Its pharmacological properties include the ability to modulate neuronal excitability, making it relevant in the treatment of epilepsy. Additionally, like many amides, it may undergo hydrolysis under certain conditions, leading to the formation of the corresponding carboxylic acid and amine. Safety data indicates that, while it has therapeutic applications, it should be handled with care due to potential side effects and toxicity associated with its use.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15)
InChI key:InChIKey=AJOQSQHYDOFIOX-UHFFFAOYSA-N
SMILES:O=C(N)NC(=O)C(C=1C=CC=CC1)CC
- Synonyms:
- (2-Phenylbutanoyl)urea
- (2-Phenylbutyryl)Urea
- 1-[(Ethyl)phenylacetyl]urea
- 2-Phenylbutyrylurea
- Benuride
- Benzeneacetamide, N-(aminocarbonyl)-α-ethyl-
- Beta�methoxynaph-talene
- Ethylphenacemide
- Lircapyl
- M 551
- See more synonyms
- N-(Aminocarbonyl)-α-ethylbenzeneacetamide
- N-(α-Phenylbutyryl)urea
- N-carbamoyl-2-phenylbutanamide
- Phenuride
- Phenylethylacetylurea
- Urea, (2-phenylbutyryl)-
- dl-Pheneturide
- α-Phenyl-α-ethylacetylurea
