CymitQuimica logo

CAS 90001-44-8

:

2-Bromo-4-formylbenzoic acid

Description:
2-Bromo-4-formylbenzoic acid is an aromatic compound characterized by the presence of a bromine atom, a formyl group, and a carboxylic acid functional group attached to a benzene ring. Its molecular structure features a bromine substituent at the second position and a formyl group at the fourth position relative to the carboxylic acid group. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of both aromatic compounds and carboxylic acids, including the ability to participate in electrophilic aromatic substitution reactions and to form hydrogen bonds due to the carboxylic acid group. The presence of the bromine atom can enhance the reactivity of the compound in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, the formyl group can serve as a versatile functional group for further transformations, allowing for the synthesis of more complex molecules. Its CAS number, 90001-44-8, is a unique identifier used for regulatory and safety purposes.
Formula:C8H5BrO3
InChI:InChI=1S/C8H5BrO3/c9-7-3-5(4-10)1-2-6(7)8(11)12/h1-4H,(H,11,12)
InChI key:InChIKey=FBBRWSVWLQWAOG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(C=O)C=C1
Synonyms:
  • Benzoic acid, 2-bromo-4-formyl-
  • Terephthalaldehydic acid, 2-bromo-
  • 2-Bromo-4-formylbenzoic acid
Found 3 products.