CymitQuimica logo

CAS 90004-06-1

:

2-cyano-N-(pyridin-2-yl)acetamide

Description:
2-Cyano-N-(pyridin-2-yl)acetamide, with the CAS number 90004-06-1, is an organic compound characterized by the presence of a cyano group (-C≡N) and an acetamide functional group (-C(=O)NH2) attached to a pyridine ring. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents due to its polar functional groups. The cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The pyridine moiety can influence the compound's electronic properties and may enhance its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of both the cyano and acetamide groups may impart unique properties, such as increased lipophilicity or specific binding interactions in biological systems. Overall, 2-cyano-N-(pyridin-2-yl)acetamide is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H7N3O
InChI:InChI=1/C8H7N3O/c9-5-4-8(12)11-7-3-1-2-6-10-7/h1-3,6H,4H2,(H,10,11,12)
SMILES:c1ccnc(c1)N=C(CC#N)O
Synonyms:
  • Acetamide, 2-cyano-N-2-pyridinyl-
  • N1-(2-pyridyl)-2-cyanoacetamide
Found 2 products.