
CAS 9001-63-2
:Lysozyme
Description:
Lysozyme is an enzyme that plays a crucial role in the immune system by breaking down bacterial cell walls, thus exhibiting antimicrobial properties. It is classified as a glycoside hydrolase and is primarily found in various bodily fluids, including saliva, tears, and egg whites. Lysozyme catalyzes the hydrolysis of glycosidic bonds in peptidoglycan, a key component of bacterial cell walls, leading to cell lysis. This enzyme is characterized by its relatively small size, typically consisting of around 129 amino acids, and it has a compact, globular structure that contributes to its stability and activity. Lysozyme exhibits optimal activity at a slightly acidic pH and is sensitive to extreme temperatures and pH levels, which can denature the protein. It is widely used in food preservation, pharmaceuticals, and as a research tool in biochemistry. Additionally, lysozyme has been studied for its potential therapeutic applications, including its role in enhancing the immune response and its use in treating bacterial infections.
Formula:Unspecified
InChI:InChI=1S/C99H159N37O23/c1-11-50(8)77(132-72(139)46-120-81(145)63(32-33-70(101)137)124-88(152)69-31-21-39-136(69)93(157)68(43-73(140)141)131-84(148)62(29-19-37-116-98(109)110)125-90(154)75(48(4)5)135-91(155)76(49(6)7)133-80(144)57(100)24-16-34-113-95(103)104)92(156)126-60(27-17-35-114-96(105)106)82(146)121-51(9)78(142)129-66(41-54-45-119-59-26-15-13-23-56(54)59)87(151)134-74(47(2)3)89(153)122-52(10)79(143)128-65(40-53-44-118-58-25-14-12-22-55(53)58)85(149)123-61(28-18-36-115-97(107)108)83(147)130-67(42-71(102)138)86(150)127-64(94(158)159)30-20-38-117-99(111)112/h12-15,22-23,25-26,44-45,47-52,57,60-69,74-77,118-119H,11,16-21,24,27-43,46,100H2,1-10H3,(H2,101,137)(H2,102,138)(H,120,145)(H,121,146)(H,122,153)(H,123,149)(H,124,152)(H,125,154)(H,126,156)(H,127,150)(H,128,143)(H,129,142)(H,130,147)(H,131,148)(H,132,139)(H,133,144)(H,134,151)(H,135,155)(H,140,141)(H,158,159)(H4,103,104,113)(H4,105,106,114)(H4,107,108,115)(H4,109,110,116)(H4,111,112,117)
InChI key:ZJCXKXFAOCLSRV-UHFFFAOYSA-N
SMILES:CCC(C)C(C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(=O)N)C(=O)NC(CCCNC(=N)N)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)N)NC(=O)C5CCCN5C(=O)C(CC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C(CCCNC(=N)N)N
Synonyms:- Muramidase
- Mucopeptide glucohydrolase
- Globulin G
- Lysozyme
- E.C. 3.2.1.17
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
