CAS 90111-58-3
:4-(Carboxymethyl)phenylboronic acid
Description:
4-(Carboxymethyl)phenylboronic acid, with the CAS number 90111-58-3, is an organoboron compound characterized by the presence of both a boronic acid group and a carboxymethyl substituent on a phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis, drug development, and as a reagent in chemical biology for the detection of sugars. The carboxymethyl group enhances its solubility and reactivity, facilitating its use in aqueous environments. Additionally, 4-(Carboxymethyl)phenylboronic acid can participate in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Its properties and reactivity make it a significant compound in both academic research and industrial applications.
Formula:C8H9BO4
InChI:InChI=1/C8H9BO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4,12-13H,5H2,(H,10,11)
SMILES:c1cc(ccc1CC(=O)O)B(O)O
Synonyms:- 2-(4-Boronophenyl)acetic acid
- 4-Acetic acid-benzeneboronic acid
- [4-(Dihydroxyboranyl)Phenyl]Acetic Acid
- 4-CARBOXYMETHYL-PHENYLBORONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Carboxymethyl)benzeneboronic acid
CAS:4-(Carboxymethyl)benzeneboronic acidFormula:C8H9BO4Purity:98%Color and Shape:White Solid-PowderMolecular weight:179.965664-CARBOXYMETHYL-PHENYLBORONIC ACID
CAS:Formula:C8H9BO4Purity:95%Color and Shape:SolidMolecular weight:179.96572-(4-Boronophenyl)acetic acid
CAS:2-(4-Boronophenyl)acetic acidFormula:C8H9BO4Purity:98%Molecular weight:179.974-(Carboxymethyl)phenylboronic acid
CAS:Formula:C8H9BO4Purity:95%Color and Shape:White to off-white powderMolecular weight:179.974-Carboxymethylphenylboronic acid
CAS:Controlled ProductApplications 4-Carboxymethylphenylboronic acid
Formula:C8H9BO4Color and Shape:NeatMolecular weight:179.974-(Carboxymethyl)phenylboronic acid
CAS:4-(Carboxymethyl)phenylboronic acid is a corrosion inhibitor that is used in the production of polyvinyl chloride, polyvinyl alcohol, and ethylene glycol. It can be used as an additive to lubricating oils and fuels. 4-(Carboxymethyl)phenylboronic acid has been shown to inhibit the corrosion of lead in hydrochloric acid solutions. This compound has also been shown to inhibit the formation of silicon-sulfide complexes in polystyrene and polyvinyl chloride.
Formula:C8H9BO4Purity:Min. 95%Molecular weight:179.97 g/mol





