
CAS 9013-20-1
:Streptavidin
Description:
Streptavidin is a tetrameric protein derived from the bacterium *Streptomyces avidinii*. It is known for its high affinity for biotin, a vitamin that plays a crucial role in various biological processes. The protein exhibits a molecular weight of approximately 60 kDa and is composed of four identical subunits, each capable of binding one molecule of biotin. Streptavidin is characterized by its stability across a range of pH levels and temperatures, making it suitable for various laboratory applications. Its strong biotin-binding capability is utilized in numerous biotechnological and diagnostic applications, including enzyme-linked immunosorbent assays (ELISA), Western blotting, and the purification of proteins. Additionally, streptavidin is often used in conjunction with biotinylated molecules to facilitate the detection and isolation of proteins, nucleic acids, and other biomolecules. Importantly, streptavidin is non-glycosylated, which reduces potential interference in assays, and it is generally considered to be less immunogenic than other similar proteins, such as avidin.
Formula:Unspecified
InChI:InChI=1S/C14H16ClNO2S.BrH/c15-12-6-4-5-11(9-12)14(19-10-13(17)18)16-7-2-1-3-8-16;/h4-6,9H,1-3,7-8,10H2;1H
InChI key:RTWACOLFHOBGCE-UHFFFAOYSA-N
SMILES:C1CC[N+](=C(C2=CC(=CC=C2)Cl)SCC(=O)O)CC1.[Br-]
Synonyms:- ArrayIt SuperStreptavidin
- Polystreptavidin
- Streptavidin
- MeSH ID: D019809
- 9: PN: KR2178813 SEQID: 9 claimed sequence
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Streptavidin from Streptomyces avidinii
CAS:Color and Shape:White to Brown to Dark green powder to crystalStreptavidin, Streptomyces avidinii
CAS:Streptavidin, 9013-20-1, is a crystalline protein isolated from the bacterium Streptomyces avidinii possessing biotin-binding capacity. Learn more at Thermo Fisher Scientific.Formula:C14H17BrClNO2SPurity:95%Molecular weight:378.71Streptavidin
CAS:Streptavidin is a protein tetramer purified from bacteria with affinity for biotin and for the purification or detection of various biomolecules.Color and Shape:White SolidStreptavidin
CAS:StreptavidinFormula:C14H17ClNO2S·BrColor and Shape:White Solid-PowderMolecular weight:378.71227Streptavidin
CAS:Biotin-binding protein.Biotin binding capacity - min 16U/mgPurity:Min. 95%Color and Shape:White Slightly Yellow PowderStreptavidin (SA) ex. Streptomyces Avidinii for molecular biology, 15U/mg Protein
CAS:Color and Shape:White to off-white, Powder, Clear to hazy, Colourless to faint yellowMolecular weight:60000.00







