CAS 902135-91-5: N-(4-Piperidinyl)-4-(2,6-dichlorobenzoylamino)-1H-pyrazole-3-carboxamide hydrochloride
Description:N-(4-Piperidinyl)-4-(2,6-dichlorobenzoylamino)-1H-pyrazole-3-carboxamide hydrochloride, with the CAS number 902135-91-5, is a synthetic compound that belongs to the class of pyrazole derivatives. This substance typically exhibits characteristics such as being a white to off-white solid, which is soluble in polar solvents like water and methanol. It is often studied for its potential pharmacological properties, particularly in the context of its role as a therapeutic agent. The presence of the piperidine and dichlorobenzoyl moieties suggests that it may interact with biological targets, potentially influencing various signaling pathways. The hydrochloride salt form enhances its solubility and stability, making it suitable for pharmaceutical applications. As with many chemical compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound represents a significant interest in medicinal chemistry, particularly for its potential applications in drug development.
Formula:C16H17Cl2N5O2.HCl
InChI:InChI=1S/C16H17Cl2N5O2.ClH/c17-10-2-1-3-11(18)13(10)15(24)22-12-8-20-23-14(12)16(25)21-9-4-6-19-7-5-9;/h1-3,8-9,19H,4-7H2,(H,20,23)(H,21,25)(H,22,24);1H
- Synonyms:
- At 7519
- N-(4-piperidinyl)-4-(2,6-dichlorobenzoylamino)-1H-pyrazole-3-carboxamide Hcl
- AT-7519(HCl)
- AT7519 HCl