CymitQuimica logo

CAS 902494-31-9

:

tert-butyl [1-(trifluoromethyl)cyclopropyl]carbamate

Description:
Tert-butyl [1-(trifluoromethyl)cyclopropyl]carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group and a cyclopropyl ring substituted with a trifluoromethyl group. This compound belongs to the class of carbamates, which are esters of carbamic acid. Its molecular structure contributes to its potential applications in medicinal chemistry and agrochemicals, particularly due to the presence of the trifluoromethyl group, which can enhance lipophilicity and metabolic stability. The tert-butyl moiety often provides steric hindrance, influencing the compound's reactivity and interaction with biological targets. Additionally, the cyclopropyl ring can impart unique conformational properties, making it of interest in drug design. The compound's physical properties, such as solubility and boiling point, would typically be influenced by its functional groups and overall molecular weight. As with many fluorinated compounds, it may exhibit distinct chemical behavior, including increased resistance to degradation. Safety and handling considerations should be taken into account due to the potential toxicity associated with fluorinated compounds.
Formula:C9H14F3NO2
InChI:InChI=1/C9H14F3NO2/c1-7(2,3)15-6(14)13-8(4-5-8)9(10,11)12/h4-5H2,1-3H3,(H,13,14)
InChI key:GHEKGGDYVHWSBM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NC1(CC1)C(F)(F)F)O
Found 4 products.