CymitQuimica logo

CAS 903129-94-2

:

Ethyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate

Description:
Ethyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate is a chemical compound characterized by its unique heterocyclic structure, which incorporates a pyrrole and triazine moiety. This compound typically exhibits a range of properties, including moderate solubility in organic solvents, which is common for many heterocycles. The presence of the ethyl ester group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. The chlorine atom in the structure can influence its electronic properties and reactivity, potentially enhancing its biological activity. Such compounds are often of interest in medicinal chemistry and agricultural applications due to their potential as bioactive agents. Additionally, the specific arrangement of atoms in the pyrrolo-triazine framework may impart unique pharmacological properties, making it a subject of research in drug development. Overall, Ethyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate represents a versatile scaffold for further chemical exploration and application.
Formula:C9H8ClN3O2
InChI:InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-3-7-8(10)11-5-12-13(7)4-6/h3-5H,2H2,1H3
InChI key:InChIKey=IBMTWUNSKPQWQV-UHFFFAOYSA-N
SMILES:ClC=1C=2N(C=C(C(OCC)=O)C2)N=CN1
Synonyms:
  • Ethyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate
  • Pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid, 4-chloro-, ethyl ester
Found 4 products.