CymitQuimica logo

CAS 903513-60-0

:

B-(2-Cyano-4-pyridinyl)boronic acid

Description:
B-(2-Cyano-4-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a cyano-substituted pyridine ring. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyano group contributes to the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. Additionally, B-(2-Cyano-4-pyridinyl)boronic acid may serve as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, particularly in the development of compounds that target specific biological pathways. Its unique structural features and reactivity profile make it a subject of interest in both academic and industrial research.
Formula:C6H5BN2O2
InChI:InChI=1S/C6H5BN2O2/c8-4-6-3-5(7(10)11)1-2-9-6/h1-3,10-11H
InChI key:InChIKey=MSBPWGHYNOCHGC-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(C#N)N=CC1
Synonyms:
  • 2-Cyanopyridin-4-ylboronic acid
  • Boronic acid, B-(2-cyano-4-pyridinyl)-
  • Boronic acid, (2-cyano-4-pyridinyl)-
  • B-(2-Cyano-4-pyridinyl)boronic acid
  • 2-Cyanopyridine-4-boronic acid
  • (2-cyanopyridin-4-yl)boronic acid
  • (2-Cyanopyridin-4-yl)
Found 4 products.