CAS 904326-93-8
:(6-Morpholino-3-pyridinyl)boronic acid
Description:
(6-Morpholino-3-pyridinyl)boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a morpholine moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate molecular weight. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The morpholine ring contributes to the compound's basicity and potential for hydrogen bonding, enhancing its reactivity and interaction with biological targets. Additionally, this compound may exhibit biological activity, particularly in the context of drug development, where boronic acids are often explored for their role in enzyme inhibition and as building blocks in the synthesis of complex molecules. Overall, (6-Morpholino-3-pyridinyl)boronic acid is a versatile compound with significant implications in both research and pharmaceutical applications.
Formula:C9H13BN2O3
InChI:InChI=1S/C9H13BN2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7,13-14H,3-6H2
InChI key:InChIKey=FFPQELNXDVTLEW-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(N=C1)N2CCOCC2
Synonyms:- (6-Morpholino-3-Pyridyl)Boronic Acid
- (6-Morpholino-3-pyridinyl)boronic acid
- 2-Morpholino-5-pyridineboronic acid
- 6-(4-Morpholin-1-yl)pyridin-3-ylboronic acid
- 6-(Morpholin-4-yl)pyridine-3-boronic acid
- 6-Morpholino-3-pyridineboronic acid
- 6-Morpholinopyridin-3-Ylboronic Acid
- B-[6-(4-Morpholinyl)-3-pyridinyl]boronic acid
- Boronic acid, B-[6-(4-morpholinyl)-3-pyridinyl]-
- Boronic acid, [6-(4-morpholinyl)-3-pyridinyl]-
- [6-(Morpholin-4-yl)pyridin-3-yl]boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Morpholino-3-pyridineboronic Acid
CAS:6-Morpholino-3-pyridineboronic AcidFormula:C9H13BN2O3Purity:98%Molecular weight:208.026-(Morpholino)pyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H13BN2O3Purity:97.0 to 110.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:208.026-(4-Morpholinyl)-3-pyridinylboronic acid
CAS:6-(4-Morpholinyl)-3-pyridinylboronic acidFormula:C9H13BN2O3Purity:98%Color and Shape:Pale yellow SolidMolecular weight:208.02212Boronic acid, B-[6-(4-morpholinyl)-3-pyridinyl]-
CAS:Formula:C9H13BN2O3Purity:97%Color and Shape:SolidMolecular weight:208.02212-(Morpholino)pyridin-5-yl boronic acid
CAS:Heterocyclic compound-pyridine, intermediate and building block-boronic acidFormula:C9H13BN2O3Color and Shape:SolidMolecular weight:208.02Ref: TM-TNU0671
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire(6-Morpholinopyridin-3-yl)boronic acid
CAS:Formula:C9H13BN2O3Purity:97%Color and Shape:SolidMolecular weight:208.02






