CAS 904696-62-4
:1-[4-(1H-pyrazol-1-ylmethyl)phenyl]methanamine hydrochloride (1:1)
Description:
1-[4-(1H-pyrazol-1-ylmethyl)phenyl]methanamine hydrochloride, with the CAS number 904696-62-4, is a chemical compound characterized by its unique structure that includes a pyrazole ring and an amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the amine and hydrochloride moiety. The presence of the pyrazole ring suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The hydrochloride salt form enhances its stability and solubility, making it suitable for various applications in medicinal chemistry and research. Additionally, the compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in the synthesis of more complex molecules. As with many amines, it may also participate in hydrogen bonding, influencing its reactivity and interactions in biological systems.
Formula:C11H14ClN3
InChI:InChI=1/C11H13N3.ClH/c12-8-10-2-4-11(5-3-10)9-14-7-1-6-13-14;/h1-7H,8-9,12H2;1H
SMILES:c1cnn(c1)Cc1ccc(cc1)CN.Cl
Synonyms:- 4-(1H-Pyrazol-1-ylmethyl)benzylamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
{4-[(1H-pyrazol-1-yl)methyl]phenyl}methanamine hydrochloride
CAS:Formula:C11H14ClN3Purity:%Molecular weight:223.70201-[4-(Aminomethyl)benzyl]-1H-pyrazole hydrochloride
CAS:1-[4-(Aminomethyl)benzyl]-1H-pyrazole hydrochloride
Purity:techColor and Shape:Grey-Black SolidMolecular weight:223.70g/mol

