CymitQuimica logo

CAS 904817-27-2

:

6-(2-pyridin-3-ylpyrrolidin-1-yl)pyridine-3-carboxylic acid

Description:
6-(2-Pyridin-3-ylpyrrolidin-1-yl)pyridine-3-carboxylic acid, with the CAS number 904817-27-2, is a chemical compound characterized by its complex structure that includes multiple nitrogen-containing heterocycles. This compound features a pyridine ring substituted with a pyrrolidine moiety, which contributes to its potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular configuration may allow for specific binding interactions, which could be relevant in drug design and development. Additionally, the presence of nitrogen atoms in the rings may enhance its ability to form hydrogen bonds, further affecting its reactivity and interactions in biological systems. Overall, this compound's unique structural features position it as a candidate for further research in pharmacology and related fields.
Formula:C15H15N3O2
InChI:InChI=1/C15H15N3O2/c19-15(20)12-5-6-14(17-10-12)18-8-2-4-13(18)11-3-1-7-16-9-11/h1,3,5-7,9-10,13H,2,4,8H2,(H,19,20)
SMILES:c1cc(cnc1)C1CCCN1c1ccc(cn1)C(=O)O
Synonyms:
  • 3-Pyridinecarboxylic Acid, 6-[2-(3-Pyridinyl)-1-Pyrrolidinyl]-
  • 6-[2-(3-Pyridinyl)-1-pyrrolidinyl]nicotinic acid
  • 6-[2-(Pyridin-3-yl)pyrrolidin-1-yl]nicotinic acid
  • Acide 6-[2-(3-pyridinyl)-1-pyrrolidinyl]nicotinique
Found 1 products.