CAS 905442-42-4

L-(7-hydroxycoumarin-4-yl) ethylglycine

Description:

L-(7-hydroxycoumarin-4-yl) ethylglycine is a chemical compound characterized by its unique structure, which combines a coumarin moiety with an ethylglycine group. The presence of the hydroxy group on the coumarin ring enhances its solubility and may contribute to its biological activity, potentially making it a candidate for various applications in medicinal chemistry. This compound is likely to exhibit fluorescence properties due to the coumarin structure, which is commonly utilized in fluorescent probes and dyes. Additionally, the ethylglycine component may impart specific pharmacological properties, such as potential neuroprotective or anti-inflammatory effects. The compound's molecular interactions can be influenced by its functional groups, making it a subject of interest in studies related to drug design and development. As with many synthetic organic compounds, its stability, reactivity, and interactions with biological systems would be critical factors in determining its practical applications. Overall, L-(7-hydroxycoumarin-4-yl) ethylglycine represents a fascinating intersection of organic chemistry and potential therapeutic use.

Formula: C13H13NO5

InChI: InChI=1S/C13H13NO5/c14-10(13(17)18)4-1-7-5-12(16)19-11-6-8(15)2-3-9(7)11/h2-3,5-6,10,15H,1,4,14H2,(H,17,18)/t10-/m1/s1

InChI key: QEQAKQQRJFWPOR-SNVBAGLBSA-N

SMILES: C1=CC2=C(C=C1O)OC(=O)C=C2CC[C@H](C(=O)O)N

H-4-(7-Hydroxycoumarin-4-yl)-Abu-OH

CAS: 905442-42-4

L-(7-hydroxycoumarin-4-yl)ethylglycine (umbelliferylethylglycine) has been incorporated into proteins as a fluorescent tag.

Formula: C₁₃H₁₃NO₅

Purity: 99.5%

Color and Shape: Pink Powder

Molecular weight: 263.25

Ref: 01-4059541

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid

CAS: 905442-42-4

Formula: C₁₃H₁₃NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 263.2460

Ref: IN-DA00IG6S

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid

CAS: 905442-42-4

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid

Formula: C₁₃H₁₃NO₅

Purity: ≥95%

Molecular weight: 263.24602

Ref: 54-OR470836

L-(7-Hydroxycoumarin-4-yl) ethylglycine

CAS: 905442-42-4

L-(7-Hydroxycoumarin-4-yl) ethylglycine is a molecule that has been used as a model system to study the binding of inhibitors to enzymes. L-(7-Hydroxycoumarin-4-yl) ethylglycine binds to the enzyme synthetase and inhibits its activity. The inhibition of this enzyme prevents the formation of ATP, which is necessary for the synthesis of proteins. L-(7-Hydroxycoumarin-4-yl) ethylglycine also blocks transcription and translation by binding to DNA binding proteins and inhibiting ribosome function respectively. This agent is an antimicrobial agent that has shown activity against gram positive bacteria such as Staphylococcus aureus, Enterococcus faecalis, and Bacillus cereus, as well as gram negative bacteria such as Escherichia coli, Salmonella typhimurium, Pseudomonas aerugin

Formula: C₁₃H₁₃NO₅

Purity: Min. 98 Area-%

Color and Shape: Red Powder

Molecular weight: 263.25 g/mol

Ref: 3D-FH09425

(S)-2-AMINO-4-(7-HYDROXY-2-OXO-2H-CHROMEN-4-YL)BUTANOIC ACID

CAS: 905442-42-4

Formula: C₁₃H₁₃NO₅

Purity: 95.0%

Molecular weight: 263.249

Ref: 10-F330966