CymitQuimica logo

CAS 90734-97-7

:

4-Methoxyindole-3-carboxaldehyde

Description:
4-Methoxyindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methoxy group (-OCH3) at the 4-position and an aldehyde group (-CHO) at the 3-position of the indole ring. It is typically a pale yellow to light brown solid or liquid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents, while the aldehyde group makes it reactive, particularly in condensation reactions. 4-Methoxyindole-3-carboxaldehyde is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anticancer properties. Its reactivity allows it to participate in various synthetic pathways, making it a valuable intermediate in organic synthesis. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-13-9-4-2-3-8-10(9)7(6-12)5-11-8/h2-6,11H,1H3
InChI key:GDVCEQRAPMIJBG-UHFFFAOYSA-N
SMILES:COc1cccc2c1c(c[nH]2)C=O
Synonyms:
  • 4-Methoxyindole-3-aldehyde
  • 1H-Indole-3-carboxaldehyde, 4-methoxy-
  • 4-methoxy-1H-indole-3-carbaldehyde
Found 5 products.