CymitQuimica logo

CAS 907597-26-6

:

3-Bromoisothiazolo[4,5-b]pyrazine

Description:
3-Bromoisothiazolo[4,5-b]pyrazine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both isothiazole and pyrazine moieties. This compound features a bromine atom at the 3-position of the isothiazole ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of both nitrogen and sulfur atoms in its structure imparts distinct electronic properties, making it of interest in medicinal chemistry and materials science. Compounds like 3-bromoisothiazolo[4,5-b]pyrazine are often studied for their biological activities, including antimicrobial and anticancer properties. Additionally, its structural features may allow for further derivatization, enhancing its utility in synthetic chemistry. As with many heterocycles, the compound's stability and reactivity can be influenced by the substituents present, making it a versatile building block in the development of novel pharmaceuticals and agrochemicals.
Formula:C5H2BrN3S
InChI:InChI=1/C5H2BrN3S/c6-4-3-5(10-9-4)8-2-1-7-3/h1-2H
InChI key:InChIKey=AFCJQWPCRDUHNK-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=NC=CN2)SN1
Synonyms:
  • 3-Bromo[1,2]thiazolo[4,5-b]pyrazine
  • 3-Bromoisothiazolo[5,4-b]pyrazine
  • Isothiazolo[4,5-B]Pyrazine, 3-Bromo-
  • 3-Bromoisothiazolo[4,5-b]pyrazine
Found 4 products.