CymitQuimica logo

CAS 908130-61-0

:

7-Deaza-2'-deoxy-7-iodoadenosine

Description:
7-Deaza-2'-deoxy-7-iodoadenosine is a modified nucleoside that belongs to the class of purine nucleosides. It features a deaza substitution at the 7-position of the adenine base, which replaces the nitrogen atom typically found in adenine with a carbon atom, thereby altering its hydrogen bonding properties and potentially influencing its biological activity. The presence of an iodine atom at the 7-position further modifies its chemical characteristics, enhancing its stability and potentially affecting its interaction with nucleic acid structures. This compound is of interest in biochemical research, particularly in studies involving nucleic acid synthesis, molecular biology, and medicinal chemistry, as it may serve as a tool for investigating the roles of nucleosides in cellular processes. Its unique structural features may also provide insights into the development of antiviral or anticancer agents. As with many modified nucleosides, its solubility, reactivity, and biological activity can differ significantly from those of unmodified nucleosides, making it a valuable compound for various applications in research and drug development.
Formula:C11H13IN4O3
InChI:InChI=1S/C11H13IN4O3/c12-5-2-16(8-1-6(18)7(3-17)19-8)11-9(5)10(13)14-4-15-11/h2,4,6-8,17-18H,1,3H2,(H2,13,14,15)/t6-,7+,8+/m1/s1
InChI key:LIIIRHQRQZIIRT-CSMHCCOUSA-N
SMILES:C1[C@H]([C@@H](O[C@@H]1N2C=C(C3=C(N=CN=C32)N)I)CO)O
Found 6 products.