CymitQuimica logo

CAS 90868-92-1

:

4-Bromo-α-cyclopropylbenzenemethanamine

Description:
4-Bromo-α-cyclopropylbenzenemethanamine, identified by its CAS number 90868-92-1, is an organic compound characterized by its unique structural features. It contains a bromine atom attached to a cyclopropyl group, which is further connected to a benzene ring and an amine functional group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine atom may also impart specific reactivity, making it a potential candidate for further chemical transformations. Additionally, the cyclopropyl group can introduce strain and unique steric effects, potentially affecting the compound's reactivity and interaction with biological systems. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often find applications in medicinal chemistry and materials science due to their diverse functional groups and structural complexity.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10H,1-2,12H2
InChI key:InChIKey=CFTNYXDVHSKCKL-UHFFFAOYSA-N
SMILES:C(N)(C1CC1)C2=CC=C(Br)C=C2
Synonyms:
  • 1-(4-Bromophenyl)-1-cyclopropylmethane amine
  • 4-Bromo-α-cyclopropylbenzenemethanamine
  • Benzylamine, p-bromo-α-cyclopropyl-
  • Benzenemethanamine, 4-bromo-α-cyclopropyl-
  • (4-Bromophenyl)(cyclopropyl)methanamine
Found 5 products.