CymitQuimica logo

CAS 90872-72-3

:

2-methyl-5-pyrrolidin-2-yl-pyridine

Description:
2-Methyl-5-pyrrolidin-2-yl-pyridine, identified by its CAS number 90872-72-3, is a chemical compound characterized by a pyridine ring substituted with a pyrrolidine group and a methyl group. This compound features a five-membered nitrogen-containing heterocycle (pyrrolidine) attached to the pyridine, which is a six-membered aromatic ring. The presence of the methyl group at the second position of the pyridine enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The compound may exhibit various pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals, can be influenced by its functional groups and overall molecular architecture. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, affecting its behavior in different environments.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c1-8-4-5-9(7-12-8)10-3-2-6-11-10/h4-5,7,10-11H,2-3,6H2,1H3
InChI key:WZVVISVPTUREQN-UHFFFAOYSA-N
SMILES:Cc1ccc(cn1)C1CCCN1
Found 5 products.