CymitQuimica logo

CAS 90902-83-3

:

2-Bromo-3-amino-5-chloropyridine

Description:
2-Bromo-3-amino-5-chloropyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains both bromine and chlorine substituents, as well as an amino group. The presence of these functional groups contributes to its reactivity and potential applications in various chemical reactions, particularly in medicinal chemistry and the synthesis of pharmaceuticals. The bromine and chlorine atoms introduce significant electronegativity, influencing the compound's polarity and solubility in different solvents. The amino group can participate in hydrogen bonding, enhancing its interaction with biological targets. This compound is typically used as an intermediate in the synthesis of more complex molecules, and its derivatives may exhibit biological activity, making it of interest in drug development. Additionally, the specific arrangement of the substituents on the pyridine ring can affect the compound's electronic properties and reactivity, which are crucial for its application in organic synthesis and medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C5H4BrClN2
InChI:InChI=1/C5H4BrClN2/c6-5-4(8)1-3(7)2-9-5/h1-2H,8H2
InChI key:AZOXQBMBDRLSCQ-UHFFFAOYSA-N
SMILES:c1c(cnc(c1N)Br)Cl
Synonyms:
  • 3-Amino-2-bromo-5-chloropyridine
  • 2-Bromo-5-Chloropyridin-3-Amine
Found 5 products.