CymitQuimica logo

CAS 90944-62-0

:

4-bromo-N,N-diethylbenzenesulfonamide

Description:
4-Bromo-N,N-diethylbenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group, which is a sulfonic acid derivative containing an amine. This compound features a bromine atom attached to the para position of a benzene ring, along with two ethyl groups connected to the nitrogen atom of the sulfonamide. The presence of the bromine substituent can influence the compound's reactivity and solubility, while the diethyl groups contribute to its lipophilicity. Typically, sulfonamides exhibit antibacterial properties, and their derivatives are often explored for pharmaceutical applications. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present and the overall molecular weight. Safety and handling considerations are essential, as with many chemical substances, particularly those containing halogens and sulfonamide groups.
Formula:C10H14BrNO2S
InChI:InChI=1/C10H14BrNO2S/c1-3-12(4-2)15(13,14)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3
InChI key:NRGTZJXYAAGKQJ-UHFFFAOYSA-N
SMILES:CCN(CC)S(=O)(=O)c1ccc(cc1)Br
Synonyms:
  • benzenesulfonamide, 4-bromo-N,N-diethyl-
  • 4-Bromo-N,N-diethylbenzenesulfonamide
Found 4 products.