CAS 91-55-4
:2,3-Dimethylindole
Description:
2,3-Dimethylindole is an organic compound belonging to the indole family, characterized by a bicyclic structure that consists of a fused benzene and pyrrole ring. It has a molecular formula of C10H11N and features two methyl groups attached to the indole ring at the 2 and 3 positions. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its role in various chemical reactions and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 2,3-Dimethylindole is soluble in organic solvents but has limited solubility in water. Its chemical properties include the ability to undergo electrophilic substitution reactions, making it a versatile building block in organic synthesis. Additionally, it exhibits some biological activity, which has led to research into its potential applications in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure.
Formula:C10H11N
InChI:InChI=1S/C10H11N/c1-7-8(2)11-10-6-4-3-5-9(7)10/h3-6,11H,1-2H3
InChI key:InChIKey=PYFVEIDRTLBMHG-UHFFFAOYSA-N
SMILES:CC=1C=2C(NC1C)=CC=CC2
Synonyms:- 1H-Indole, 2,3-dimethyl-
- 2,3-dimethyl-1H-indole
- 2,3-dimethyl-3H-indole
- Indole, 2,3-dimethyl-
- NSC 24936
- 2,3-Dimethylindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Dimethylindole
CAS:Formula:C10H11NPurity:>98.0%(GC)Color and Shape:White to Amber powder to crystalMolecular weight:145.212,3-Dimethyl-1H-indole
CAS:2,3-Dimethyl-1H-indoleFormula:C10H11NPurity:99%Color and Shape:Light red. Solid-CrystalsMolecular weight:145.201042,3-Dimethylindole
CAS:Formula:C10H11NPurity:≥ 98.0%Color and Shape:White to light yellow or beige crystalline powderMolecular weight:145.212,3-Dimethylindole
CAS:2,3-Dimethylindole (2,3-dimethylindole) is a fine chemical that is used as a building block in the synthesis of other chemicals. It is classified as a research chemical and can be found under CAS No. 91-55-4. 2,3-Dimethylindole can be used to make a wide range of compounds and has many uses in the pharmaceutical industry. This compound is a versatile building block that can react with other compounds to form more complex molecules. 2,3-Dimethylindole is also a useful intermediate in the production of organic or organometallic compounds.Formula:C10H11NPurity:Min. 98 Area-%Molecular weight:145.21 g/molRef: 3D-D-5350
-Unit-ggTo inquire25gTo inquire50gTo inquire100gTo inquire250gTo inquire500gTo inquire





