CymitQuimica logo

CAS 910443-61-7

:

1-[1-(2-methoxyethyl)pyrrolidin-3-yl]methanamine

Description:
1-[1-(2-methoxyethyl)pyrrolidin-3-yl]methanamine, with the CAS number 910443-61-7, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring substituted with a methanamine group and a 2-methoxyethyl side chain. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the methoxyethyl group may enhance its lipophilicity, potentially affecting its pharmacokinetic properties if it is studied for biological activity. The compound's molecular structure suggests it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, its synthesis and stability under various conditions would be relevant for applications in research or pharmaceutical development. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C8H18N2O
InChI:InChI=1/C8H18N2O/c1-11-5-4-10-3-2-8(6-9)7-10/h8H,2-7,9H2,1H3
SMILES:COCCN1CCC(CN)C1
Synonyms:
  • 3-Pyrrolidinemethanamine, 1-(2-Methoxyethyl)-
Found 2 products.