CymitQuimica logo

CAS 91062-48-5

:

5-bromo-2-morpholin-4-ylaniline

Description:
5-Bromo-2-morpholin-4-ylaniline is an organic compound characterized by the presence of a bromine atom, a morpholine ring, and an aniline structure. Its molecular formula typically includes elements such as carbon, hydrogen, nitrogen, and bromine, reflecting its complex structure. The morpholine moiety contributes to its potential as a versatile building block in medicinal chemistry, often enhancing solubility and biological activity. This compound is likely to exhibit moderate to high polarity due to the presence of the morpholine and amino groups, which can engage in hydrogen bonding. Additionally, the bromine substituent can influence its reactivity and stability, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound may also possess specific pharmacological properties, making it of interest in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 5-bromo-2-morpholin-4-ylaniline represents a significant compound in the realm of organic synthesis and pharmaceutical research.
Formula:C10H13BrN2O
InChI:InChI=1/C10H13BrN2O/c11-8-1-2-10(9(12)7-8)13-3-5-14-6-4-13/h1-2,7H,3-6,12H2
InChI key:JAINJKOIAULFCQ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)N)N1CCOCC1
Found 2 products.