CymitQuimica logo

CAS 91089-68-8

:

2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)acetamide

Description:
2-Chloro-N-(3,4-dihydro-2H-chromen-4-yl)acetamide is a chemical compound characterized by its unique structural features, which include a chloro substituent and a chromenyl moiety. The presence of the chloro group suggests that it may exhibit reactivity typical of halogenated compounds, potentially influencing its biological activity and interaction with other molecules. The chromenyl structure, derived from chromene, contributes to its aromatic characteristics and may impart specific pharmacological properties. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the presence of both polar and non-polar functional groups. Its acetamide functional group indicates potential for hydrogen bonding, which can affect its solubility and reactivity. The compound may be of interest in medicinal chemistry, particularly for its potential therapeutic applications, given the biological significance of both chloro and chromene derivatives. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H12ClNO2
InChI:InChI=1/C11H12ClNO2/c12-7-11(14)13-9-5-6-15-10-4-2-1-3-8(9)10/h1-4,9H,5-7H2,(H,13,14)
SMILES:c1ccc2c(c1)C(CCO2)N=C(CCl)O
Found 1 products.