CAS 91147-43-2
:6-Quinoxalinamine, N-(4,5-dihydro-1H-imidazol-2-yl)-
Description:
6-Quinoxalinamine, N-(4,5-dihydro-1H-imidazol-2-yl)-, with the CAS number 91147-43-2, is a chemical compound that features a quinoxaline core, which is a bicyclic structure composed of two fused aromatic rings. This compound is characterized by the presence of an amine functional group and an imidazole moiety, contributing to its potential biological activity. The imidazole ring is known for its role in various biochemical processes and can influence the compound's solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate to high polarity, which can affect their interaction with biological systems. Additionally, the presence of nitrogen atoms in both the quinoxaline and imidazole rings may impart unique electronic properties, making it of interest in medicinal chemistry for potential applications in drug development. Overall, this compound's structural features suggest it could be investigated for various pharmacological activities, although specific biological data would be necessary to elucidate its potential uses.
Formula:C11H11N5
InChI:InChI=1S/C11H11N5/c1-2-9-10(13-4-3-12-9)7-8(1)16-11-14-5-6-15-11/h1-4,7H,5-6H2,(H2,14,15,16)
InChI key:PVKUNRLEOHFACD-UHFFFAOYSA-N
SMILES:C1CN=C(N1)NC2=CC3=NC=CN=C3C=C2
Synonyms:- N-(imidazolidin-2-ylidene)quinoxalin-6-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Desbromo Brimonidine (N-(Quinoxalin-6-yl)imidazolidin-2-imine)
CAS:Compounds containing an unfused imidazole ring, whether or not hydrogenated, in the structure, nesoiFormula:C11H11N5Color and Shape:Dark Brown SolidMolecular weight:213.10145N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
CAS:N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amineFormula:C11H11N5Purity:98%Molecular weight:213.24N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
CAS:Formula:C11H11N5Purity:98%Color and Shape:SolidMolecular weight:213.2385Brimonidine EP Impurity A (Desbromo Brimonidine)
CAS:Formula:C11H11N5Color and Shape:Yellow SolidMolecular weight:213.24N-(Imidazolidin-2-ylidene)quinoxalin-6-amine
CAS:Controlled ProductFormula:C11H11N5Color and Shape:NeatMolecular weight:213.24N-(4,5-Dihydro-1H-imidazol-2-yl)quinoxalin-6-amine
CAS:N-(4,5-Dihydro-1H-imidazol-2-yl)quinoxalin-6-amineFormula:C11H11N5Purity:97%Molecular weight:213.24Desbromo Brimonidine
CAS:Impurity Brimonidine EP Impurity A
Applications N-(4,5-Dihydro-1H-imidazol-2-yl)-6-quinoxalinamine is an analogue of Brimonidine (B677520), a α2-Adrenoceptor agonist and antiglaucoma agent.
References Jeon, Y.T., et al.: Bioorg. Med. Chem., 5, 2255 (1995); Katz, L.J., et al.: Am. J. Ophthalmol., 127, 20 (1999); Cantor, L. B., Expert Opin. Pharmacother., 1, 815 (2000)Formula:C11H11N5Color and Shape:NeatMolecular weight:213.24N-(4,5-Dihydro-1H-imidazol-2-yl)-6-quinoxalinamine
CAS:Please enquire for more information about N-(4,5-Dihydro-1H-imidazol-2-yl)-6-quinoxalinamine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H11N5Purity:Min. 95%Color and Shape:PowderMolecular weight:213.24 g/molDesbromo Brimonidine D4
CAS:Controlled ProductFormula:C11D4H7N5Color and Shape:NeatMolecular weight:217.263









