CymitQuimica logo

CAS 91166-50-6

:

Bis(dimethylaminodimethylsilyl)ethane

Description:
Bis(dimethylaminodimethylsilyl)ethane, with the CAS number 91166-50-6, is an organosilicon compound characterized by its unique structure that features two dimethylaminodimethylsilyl groups attached to an ethane backbone. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity, particularly in the presence of moisture, which can lead to hydrolysis and the formation of silanol groups. It exhibits properties such as low volatility and moderate viscosity, making it useful in various applications, including as a precursor in the synthesis of silicon-based materials and as a coupling agent in polymer chemistry. The presence of dimethylamino groups imparts basicity, which can enhance its reactivity in certain chemical processes. Additionally, its silane functionality allows for potential applications in surface modification and as a crosslinking agent in the production of silicone polymers. Safety precautions should be observed when handling this compound due to its reactivity and potential health hazards.
Formula:C10H28N2Si2
InChI:InChI=1/C10H28N2Si2/c1-11(2)13(5,6)9-10-14(7,8)12(3)4/h9-10H2,1-8H3
InChI key:MRAAXSSHMOFDJR-UHFFFAOYSA-N
SMILES:CN(C)[Si](C)(C)CC[Si](C)(C)N(C)C
Synonyms:
  • Ethane-1,2-diylbis(N,N,1,1-tetramethylsilanamine)
  • silanamine, 1,1'-(1,2-ethanediyl)bis[N,N,1,1-tetramethyl-
Found 5 products.