CymitQuimica logo

CAS 91225-70-6

:

2-(chloromethyl)-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one

Description:
2-(Chloromethyl)-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, with the CAS number 91225-70-6, is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both thieno and pyrimidinone moieties. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of multiple rings contributes to its rigidity and may influence its biological activity. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The thieno and pyrimidinone components suggest possible interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can vary based on its molecular structure, which is crucial for its application in various chemical and biological contexts. Overall, this compound exemplifies the diversity of heterocyclic chemistry and its relevance in developing new therapeutic agents.
Formula:C10H9ClN2OS
InChI:InChI=1/C10H9ClN2OS/c11-4-7-12-9(14)8-5-2-1-3-6(5)15-10(8)13-7/h1-4H2,(H,12,13,14)
SMILES:C1Cc2c(C1)sc1c2c(nc(CCl)n1)O
Synonyms:
  • 4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, 2-(chloromethyl)-3,5,6,7-tetrahydro-
  • 5H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-ol, 2-(chloromethyl)-6,7-dihydro-
  • 2-(Chloromethyl)-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one
Found 2 products.