CymitQuimica logo

CAS 91240-30-1

:

Ethyl 5-isopropyl-3-isoxazolecarboxylate

Description:
Ethyl 5-isopropyl-3-isoxazolecarboxylate is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the isopropyl group enhances its hydrophobic characteristics, potentially influencing its biological activity and interactions. Ethyl 5-isopropyl-3-isoxazolecarboxylate is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Its unique structure may also impart specific properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the diverse applications of isoxazole derivatives in various fields of chemical research.
Formula:C9H13NO3
InChI:InChI=1/C9H13NO3/c1-4-12-9(11)7-5-8(6(2)3)13-10-7/h5-6H,4H2,1-3H3
InChI key:PVQVIEIJKPRYEI-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc(C(C)C)on1
Synonyms:
  • 3-Isoxazolecarboxylic Acid, 5-(1-Methylethyl)-, Ethyl Ester
  • Ethyl 5-isopropyl-1,2-oxazole-3-carboxylate
  • Ethyl 5-(Propan-2-Yl)-1,2-Oxazole-3-Carboxylate
Found 3 products.