CAS 913835-65-1
:Boronicacid, B-4-pyridinyl-, hydrochloride (1:1)
Description:
Boronic acid derivatives, such as B-4-pyridinyl boronic acid hydrochloride, are characterized by the presence of a boron atom bonded to a hydroxyl group and an aromatic ring, in this case, a pyridine. This compound typically exhibits properties associated with both boronic acids and pyridine derivatives, including the ability to form reversible covalent bonds with diols, making them useful in various applications such as drug development and materials science. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and stability. Additionally, boronic acids are known for their role in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. The presence of the pyridine ring may also impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, B-4-pyridinyl boronic acid hydrochloride is a versatile compound with significant implications in both synthetic chemistry and medicinal applications.
Formula:C5H6BNO2ClH
InChI:InChI=1S/C5H6BNO2.ClH/c8-6(9)5-1-3-7-4-2-5;/h1-4,8-9H;1H
InChI key:NCZXYQJUECNKAD-UHFFFAOYSA-N
SMILES:B(C1=CC=NC=C1)(O)O.Cl
Synonyms:- Boronicacid, 4-pyridinyl-, hydrochloride (9CI)
- Pyridin-4-Ylboronic Acid,Hydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pyridine-4-boronic acid hydrochloride, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H7BClNO2Purity:95%Molecular weight:159.38Pyridine-4-boronic acid hydrochloride
CAS:Pyridine-4-boronic acid hydrochlorideFormula:C5H6BNO2·ClHPurity:≥95%Color and Shape:SolidMolecular weight:159.37858PYRIDINE-4-BORONIC ACID HYDROCHLORIDE
CAS:Formula:C5H7BClNO2Purity:96%Color and Shape:SolidMolecular weight:159.3786Pyridin-4-ylboronic acid hydrochloride
CAS:Pyridin-4-ylboronic acid hydrochlorideFormula:C5H7BClNO2Purity:98%Molecular weight:159.38Pyridine-4-boronic acid hydrochloride
CAS:Formula:C5H7BClNO2Purity:96%Color and Shape:SolidMolecular weight:159.38




