CymitQuimica logo

CAS 913835-65-1

:

Boronicacid, B-4-pyridinyl-, hydrochloride (1:1)

Description:
Boronic acid derivatives, such as B-4-pyridinyl boronic acid hydrochloride, are characterized by the presence of a boron atom bonded to a hydroxyl group and an aromatic ring, in this case, a pyridine. This compound typically exhibits properties associated with both boronic acids and pyridine derivatives, including the ability to form reversible covalent bonds with diols, making them useful in various applications such as drug development and materials science. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in water and stability. Additionally, boronic acids are known for their role in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. The presence of the pyridine ring may also impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, B-4-pyridinyl boronic acid hydrochloride is a versatile compound with significant implications in both synthetic chemistry and medicinal applications.
Formula:C5H6BNO2ClH
InChI:InChI=1S/C5H6BNO2.ClH/c8-6(9)5-1-3-7-4-2-5;/h1-4,8-9H;1H
InChI key:NCZXYQJUECNKAD-UHFFFAOYSA-N
SMILES:B(C1=CC=NC=C1)(O)O.Cl
Synonyms:
  • Boronicacid, 4-pyridinyl-, hydrochloride (9CI)
  • Pyridin-4-Ylboronic Acid,Hydrochloride
Found 5 products.