CymitQuimica logo

CAS 913835-80-0

:

B-(2-Bromo-6-fluorophenyl)boronic acid

Description:
B-(2-Bromo-6-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both bromine and fluorine atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. The presence of the bromine and fluorine substituents can influence its reactivity and interactions, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. Boronic acids are known for their ability to form reversible complexes with diols, which is a key feature in applications such as drug development and materials science. Additionally, B-(2-Bromo-6-fluorophenyl)boronic acid can serve as a valuable building block in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds in the synthesis of complex organic molecules. Its unique structural features and reactivity profile make it a compound of interest in both academic research and industrial applications.
Formula:C6H5BBrFO2
InChI:InChI=1S/C6H5BBrFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,10-11H
InChI key:InChIKey=MVSHYHSMIRBRGU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Br)C=CC=C1F
Synonyms:
  • 2-Bromo-6-fluorophenylboronic acid
  • Boronic acid, B-(2-bromo-6-fluorophenyl)-
  • Boronic acid, (2-bromo-6-fluorophenyl)-
  • B-(2-Bromo-6-fluorophenyl)boronic acid
Found 4 products.