CymitQuimica logo

CAS 914225-70-0

:

1-(5-Fluoro-2-iodophenyl)ethanone

Description:
1-(5-Fluoro-2-iodophenyl)ethanone, with the CAS number 914225-70-0, is an organic compound characterized by its unique functional groups and halogen substituents. It features a phenyl ring substituted with both a fluorine and an iodine atom, which can influence its reactivity and biological activity. The presence of the ethanone functional group (a ketone) indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, contributing to its chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative halogens, which can affect its solubility in various solvents. Additionally, the halogen atoms may impart specific reactivity patterns, making it of interest in medicinal chemistry and material science. Its synthesis and applications may involve reactions typical of halogenated compounds, such as nucleophilic substitutions or coupling reactions. Overall, 1-(5-Fluoro-2-iodophenyl)ethanone is a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C8H6FIO
InChI:InChI=1S/C8H6FIO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3
InChI key:InChIKey=NRLSRIONJVBZDT-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(I)C=CC(F)=C1
Synonyms:
  • 1-(5-Fluoro-2-iodophenyl)ethan-1-one
  • 1-(5-Fluoro-2-iodophenyl)ethanone
  • 5'-fluoro-2'-Iodoacetophenone
  • Ethanone, 1-(5-fluoro-2-iodophenyl)-
Found 4 products.