CymitQuimica logo

CAS 914306-50-6

:

K0559

Description:
K0559, identified by its CAS number 914306-50-6, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. While specific details about its characteristics may vary based on its application, K0559 is generally recognized for its role as a selective inhibitor of certain biological pathways. It may exhibit properties such as solubility in organic solvents, stability under standard laboratory conditions, and a specific mechanism of action that targets particular enzymes or receptors. The compound's efficacy and safety profile would typically be evaluated through preclinical and clinical studies, focusing on its pharmacokinetics, pharmacodynamics, and potential therapeutic benefits. As with many chemical substances, understanding its structure-activity relationship is crucial for optimizing its use in research or therapeutic contexts. For precise applications and characteristics, consulting specialized literature or databases is recommended, as ongoing research may provide new insights into its properties and uses.
Formula:C21H24N2
InChI:InChI=1S/C21H24N2/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17/h5-16H,1-4H3
InChI key:DGCQHTACQZUATF-UHFFFAOYSA-N
SMILES:CC(C)C1=C(C(=CC=C1)C(C)C)N2C=CN=C2C3=CC=CC=C3
Synonyms:
  • 1-(2,6-Diisopropylphenyl)-2-phenyl-1H-imidazole
Found 4 products.