CymitQuimica logo

CAS 914636-21-8

:

2-Amino-3-[[[4-(methylthio)phenyl]methylene]amino]-2-butenedinitrile

Description:
2-Amino-3-[[[4-(methylthio)phenyl]methylene]amino]-2-butenedinitrile, identified by its CAS number 914636-21-8, is an organic compound characterized by its complex structure, which includes an amino group, a dinitrile functional group, and a methylthio-substituted phenyl moiety. This compound typically exhibits properties associated with both amines and nitriles, such as potential reactivity in nucleophilic addition reactions due to the presence of the amino group and the electron-withdrawing nature of the dinitrile. The methylthio group may influence its solubility and reactivity, potentially enhancing lipophilicity. The compound's structure suggests it may participate in various chemical reactions, including condensation and substitution reactions, making it of interest in synthetic organic chemistry. Additionally, due to its unique functional groups, it may exhibit biological activity, warranting investigation for potential applications in pharmaceuticals or agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise characterization.
Formula:C12H10N4S
InChI:InChI=1S/C12H10N4S/c1-17-10-4-2-9(3-5-10)8-16-12(7-14)11(15)6-13/h2-5,8H,15H2,1H3
InChI key:InChIKey=XKJSGGYMECUZTM-UHFFFAOYSA-N
SMILES:C(=NC(=C(C#N)N)C#N)C1=CC=C(SC)C=C1
Synonyms:
  • 2-Butenedinitrile, 2-amino-3-[[[4-(methylthio)phenyl]methylene]amino]-
  • 2-Amino-3-[[[4-(methylthio)phenyl]methylene]amino]-2-butenedinitrile
Found 2 products.