CymitQuimica logo

CAS 914636-42-3

:

3-Amino-4-[(1,3-benzodioxol-5-ylmethylene)amino]benzoic acid

Description:
3-Amino-4-[(1,3-benzodioxol-5-ylmethylene)amino]benzoic acid, with the CAS number 914636-42-3, is an organic compound characterized by its complex structure that includes an amino group, a benzoic acid moiety, and a benzodioxole unit. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the carboxylic acid and amino functional groups, which can engage in hydrogen bonding. The benzodioxole structure contributes to its potential for aromatic interactions and may influence its biological activity. The compound may also display moderate to high stability under standard conditions, although its reactivity can vary depending on the functional groups present. Its unique structure suggests potential applications in pharmaceuticals or as a biochemical probe, particularly in studies related to enzyme inhibition or receptor binding. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C15H12N2O4
InChI:InChI=1S/C15H12N2O4/c16-11-6-10(15(18)19)2-3-12(11)17-7-9-1-4-13-14(5-9)21-8-20-13/h1-7H,8,16H2,(H,18,19)
InChI key:InChIKey=BZKWQOKSMHKAGI-UHFFFAOYSA-N
SMILES:C(=NC1=C(N)C=C(C(O)=O)C=C1)C=2C=C3C(=CC2)OCO3
Synonyms:
  • Benzoic acid, 3-amino-4-[(1,3-benzodioxol-5-ylmethylene)amino]-
  • 3-Amino-4-[(1,3-benzodioxol-5-ylmethylene)amino]benzoic acid
Found 2 products.