CymitQuimica logo

CAS 914637-34-6

:

5-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid

Description:
5-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The oxazole moiety can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Its unique structure may also impart specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and applications. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the carboxylic acid group, which can be corrosive. Overall, 5-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid represents a versatile building block in chemical synthesis.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-8(2,3)6-5(7(10)11)9-4-12-6/h4H,1-3H3,(H,10,11)
InChI key:InChIKey=ZCFUUADBHFEUFP-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(C(O)=O)N=CO1
Synonyms:
  • 4-Oxazolecarboxylic acid, 5-(1,1-dimethylethyl)-
  • 5-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid
Found 5 products.