CymitQuimica logo

CAS 914637-67-5

:

1-[2-Fluoro-4-(methylsulfonyl)phenyl]-3-piperidinecarboxylic acid

Description:
1-[2-Fluoro-4-(methylsulfonyl)phenyl]-3-piperidinecarboxylic acid, with CAS number 914637-67-5, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a fluorine atom and a methylsulfonyl group on the phenyl ring enhances its chemical properties, potentially influencing its biological activity and solubility. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Additionally, the presence of the sulfonyl group may impart unique electronic properties, affecting the compound's overall stability and reactivity. Overall, this compound's characteristics make it a subject of interest for further research in pharmaceutical applications and chemical synthesis.
Formula:C13H16FNO4S
InChI:InChI=1S/C13H16FNO4S/c1-20(18,19)10-4-5-12(11(14)7-10)15-6-2-3-9(8-15)13(16)17/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17)
InChI key:InChIKey=LQDSRWORXHXPED-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(S(C)(=O)=O)=C1)N2CC(C(O)=O)CCC2
Synonyms:
  • 3-Piperidinecarboxylic acid, 1-[2-fluoro-4-(methylsulfonyl)phenyl]-
  • 1-[2-Fluoro-4-(methylsulfonyl)phenyl]-3-piperidinecarboxylic acid
Found 1 products.