CymitQuimica logo

CAS 914637-68-6

:

6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole-3-carboxylic acid

Description:
6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole-3-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and an imidazole ring. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of nitrogen atoms in the rings enhances its ability to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of biologically active molecules, particularly in the fields of pharmaceuticals and agrochemicals. The compound's solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in practical applications. Additionally, its specific interactions with biological targets can be explored for therapeutic purposes, particularly in areas related to neurological or metabolic disorders. Overall, 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole-3-carboxylic acid represents a valuable scaffold for further chemical exploration and development.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c10-7(11)5-4-8-6-2-1-3-9(5)6/h4H,1-3H2,(H,10,11)
InChI key:InChIKey=GDAOCGTXUVDBOC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N2C(=NC1)CCC2
Synonyms:
  • 5H-Pyrrolo[1,2-a]imidazole-3-carboxylic acid, 6,7-dihydro-
  • 6,7-Dihydro-5H-pyrrolo[1,2-a]imidazole-3-carboxylic acid
Found 3 products.