CymitQuimica logo

CAS 914637-88-0

:

3-Bromo-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole

Description:
3-Bromo-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and an imidazole ring. The presence of a bromine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may show varying degrees of stability depending on environmental conditions. Its structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. The compound may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of electron-rich nitrogen atoms in its rings. As with many heterocycles, the specific characteristics, such as melting point, boiling point, and spectral properties, can vary and are essential for understanding its behavior in different chemical contexts. Overall, 3-Bromo-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole represents a valuable scaffold in organic synthesis and pharmaceutical research.
Formula:C6H7BrN2
InChI:InChI=1S/C6H7BrN2/c7-5-4-8-6-2-1-3-9(5)6/h4H,1-3H2
InChI key:InChIKey=PDWIPFQOYQLXTK-UHFFFAOYSA-N
SMILES:BrC=1N2C(CCC2)=NC1
Synonyms:
  • 3-Bromo-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
  • 5H-Pyrrolo[1,2-a]imidazole, 3-bromo-6,7-dihydro-
  • 3-Bromo-5H,6H,7H-pyrrolo[1,2-a]imidazole
Found 4 products.