CAS 915087-25-1
:N-Methyl-4-amino-2-fluoro-benzamide
Description:
N-Methyl-4-amino-2-fluoro-benzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a methyl group, and a fluorine atom. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The fluorine atom introduces electronegativity, which can influence the compound's reactivity and interaction with biological targets. This compound is likely to exhibit moderate to high polarity due to the functional groups present. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications to the benzamide framework can lead to compounds with specific biological activities. Additionally, the presence of both a methyl group and a fluorine atom may affect the compound's lipophilicity and pharmacokinetic properties. Overall, N-Methyl-4-amino-2-fluoro-benzamide represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.
Formula:C8H9FN2O
InChI:InChI=1S/C8H9FN2O/c1-11-8(12)6-3-2-5(10)4-7(6)9/h2-4H,10H2,1H3,(H,11,12)
SMILES:CN=C(c1ccc(cc1F)N)O
Synonyms:- N-Methyl-2-Fluoro-4-Aminobenzamide
- 4-Amino-2-Fluoro-N-Methylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Benzamide, 4-amino-2-fluoro-N-methyl-
CAS:Formula:C8H9FN2OPurity:98%Color and Shape:SolidMolecular weight:168.16834-Amino-2-fluoro-N-methylbenzamide
CAS:4-Amino-2-fluoro-N-methylbenzamideFormula:C8H9FN2OPurity:98%Molecular weight:168.168264-Amino-2-fluoro-N-methylbenzamide
CAS:Controlled ProductStability Moisture Sensitive
Applications 4-Amino-2-fluoro-N-methylbenzamide acts as a reagent in the design, synthesis and biological evaluation of novel 5-oxo-2-thioxoimidazolidine derivatives as potent androgen receptor antagonists. Also, in the preparation and structure-activity relationship of chiral benzyloxypyridinone derivatives as c-Met kinase inhibitors
References Ivachtchenko, A. V., et al.: Eur. J. Med. Chem., 99, 51 (2015); Zhang, D., et al.: Bioorg. Med. Chem. Lett., 23, 2408 (2013)Formula:C8H9FN2OColor and Shape:NeatMolecular weight:168.174-Amino-2-fluoro-N-methylbenzamide
CAS:4-Amino-2-fluoro-N-methylbenzamideFormula:C8H9FN2OPurity:98%Molecular weight:168.174-Amino-2-fluoro-N-methylbenzamide
CAS:Formula:C8H9FN2OPurity:98%Color and Shape:SolidMolecular weight:168.171N-Methyl-2-fluoro-4-aminobenzamide
CAS:N-Methyl-2-fluoro-4-aminobenzamide is a toxic compound that is commonly used as a reagent in chemical synthesis and research. It has been studied for its potential use in medicine, particularly in the treatment of castration-resistant prostate cancer. N-Methyl-2-fluoro-4-aminobenzamide acts as a nucleophilic agent, participating in reactions that involve the addition of an acyl group to a target molecule. Its stable formyl group allows for efficient reaction yields and reliable results. However, due to its toxic nature, caution must be exercised when handling this compound.Formula:C8H9FN2OPurity:Min. 95%Molecular weight:168.17 g/mol







