CAS 915363-56-3

8-chloro-4-(3-chloro-4-fluoro-anilino)-6-[[1-(1-ethyl-4-piperidyl)triazol-4-yl]methylamino]quinoline-3-carbonitrile

Description:

8-Chloro-4-(3-chloro-4-fluoro-anilino)-6-[[1-(1-ethyl-4-piperidyl)triazol-4-yl]methylamino]quinoline-3-carbonitrile is a complex organic compound characterized by its multi-functional structure, which includes a quinoline core, various halogen substituents, and a piperidine moiety. This compound features a chloro and a fluoro group, which can influence its biological activity and lipophilicity. The presence of a triazole ring suggests potential for interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its carbonitrile group may contribute to its reactivity and solubility properties. The intricate arrangement of functional groups indicates that this compound may exhibit specific pharmacological properties, potentially acting as an inhibitor or modulator in various biological pathways. Due to its complexity, the synthesis and characterization of this compound would require advanced techniques in organic chemistry, and its safety and handling would need to be assessed in accordance with standard laboratory protocols.

Formula: C₂₆H₂₅Cl₂FN₈

InChI: InChI=1/C26H25Cl2FN8/c1-2-36-7-5-20(6-8-36)37-15-19(34-35-37)14-31-18-9-21-25(33-17-3-4-24(29)22(27)10-17)16(12-30)13-32-26(21)23(28)11-18/h3-4,9-11,13,15,20,31H,2,5-8,14H2,1H3,(H,32,33)

InChI key: PHNZIIMWDVXPGG-UHFFFAOYSA-N

SMILES: CCN1CCC(CC1)n1cc(CNc2cc3c(c(C#N)cnc3c(c2)Cl)Nc2ccc(c(c2)Cl)F)nn1

Cot inhibitor-2

CAS: 915363-56-3

Cot inhibitor-2

Formula: C₂₆H₂₅Cl₂FN₈

Color and Shape: Solid

Molecular weight: 539.4347

Ref: 54-BISN0305

Cot inhibitor-2

CAS: 915363-56-3

Cot inhibitor-2

Formula: C₂₆H₂₅Cl₂FN₈

Purity: 99.5%

Molecular weight: 539.43

Ref: 54-BUP07025

Cot inhibitor-2

CAS: 915363-56-3

Formula: C₂₆H₂₅Cl₂FN₈

Molecular weight: 539.4347

Ref: IN-DA00GU2M

Cot inhibitor-2

CAS: 915363-56-3

Cot inhibitor-2: Potent, selective Tpl2/MAP3K8 blocker. IC50: 1.6 nM; hampers LPS-induced TNF-α, IC50: 0.3 μM. Orally active.

Formula: C₂₆H₂₅Cl₂FN₈

Purity: 99.85%

Color and Shape: Solid

Molecular weight: 539.435

Ref: TM-T10866