CAS 915410-70-7: methyl N-[2-[(2,4-dimethyl-5-phenyl-pyrazol-3-yl)oxymethyl]phenyl]-N-methoxy-carbamate
Description:Methyl N-[2-[(2,4-dimethyl-5-phenyl-pyrazol-3-yl)oxymethyl]phenyl]-N-methoxy-carbamate, identified by its CAS number 915410-70-7, is a chemical compound characterized by its complex structure, which includes a carbamate functional group, a methoxy group, and a pyrazole moiety. This compound typically exhibits properties associated with both organic and medicinal chemistry, potentially serving as a bioactive agent or pharmaceutical intermediate. Its molecular structure suggests it may possess specific interactions with biological targets, making it of interest in drug development. The presence of the pyrazole ring indicates potential for diverse biological activities, including anti-inflammatory or analgesic effects. Additionally, the methoxy and carbamate groups may influence its solubility, stability, and reactivity. As with many organic compounds, the characteristics such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the substance. Safety and handling precautions are essential, as with any chemical, to mitigate risks associated with exposure or reactivity.
Formula:C21H23N3O4
InChI:InChI=1/C21H23N3O4/c1-15-19(16-10-6-5-7-11-16)22-23(2)20(15)28-14-17-12-8-9-13-18(17)24(27-4)21(25)26-3/h5-13H,14H2,1-4H3
InChI key:InChIKey=DWTVBEZBWMDXIY-UHFFFAOYSA-N
SMILES:O=C(OC)N(OC)C=1C=CC=CC1COC2=C(C(=NN2C)C=3C=CC=CC3)C
- Synonyms:
- 915410-70-7
- Carbamic acid, N-[2-[[(1,4-dimethyl-3-phenyl-1H-pyrazol-5-yl)oxy]methyl]phenyl]-N-methoxy-, methyl ester
- Pyrametostrobin
- Syp 4155
- T5Nnj A1 Cr& D1 Eo1R Bno1& Vo1
![methyl N-[2-[(2,4-dimethyl-5-phenyl-pyrazol-3-yl)oxymethyl]phenyl]-N-methoxy-carbamate](https://static.cymitquimica.com/cas-image/392408-methyl-n-2-24-dimethyl-5-phenyl-pyrazol-3-yl-oxymethyl-phenyl-n-methoxy-carbamate.png)
