CymitQuimica logo

CAS 915411-02-8

:

1H-Indazole, 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
1H-Indazole, 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 915411-02-8, is a chemical compound that features a fused indazole ring system, which is a bicyclic structure containing both a five-membered and a six-membered ring. The presence of the boron-containing dioxaborolane moiety introduces unique reactivity and properties, particularly in terms of its potential applications in organic synthesis and medicinal chemistry. This compound is characterized by its stability under standard conditions, although it may be sensitive to moisture due to the boron atom. The tetramethyl substituents enhance its steric bulk, which can influence its reactivity and interactions with other molecules. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the indazole and the boron-containing group, making it a candidate for further studies in fields such as drug development and materials science. Overall, its structural features suggest potential utility in various chemical applications.
Formula:C13H17BN2O2
InChI:InChI=1S/C13H17BN2O2/c1-12(2)13(3,4)18-14(17-12)10-7-5-6-9-8-15-16-11(9)10/h5-8H,1-4H3,(H,15,16)
InChI key:KZRYMNAPWVDMDN-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cccc3c[nH]nc23)O1
Synonyms:
  • 7-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole
Found 6 products.