CymitQuimica logo

CAS 915922-88-2

:

α-Methyl-3-(4-methylphenyl)-1,2,4-oxadiazole-5-methanamine

Description:
α-Methyl-3-(4-methylphenyl)-1,2,4-oxadiazole-5-methanamine, identified by its CAS number 915922-88-2, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methyl group at the α-position and a 4-methylphenyl substituent, contributing to its aromatic characteristics and potentially influencing its reactivity and solubility. The presence of the methanamine functional group suggests that it may exhibit basic properties and could participate in various chemical reactions, including nucleophilic substitutions. The oxadiazole moiety is often associated with biological activity, making this compound of interest in medicinal chemistry and drug development. Its specific physical and chemical properties, such as melting point, boiling point, solubility, and spectral characteristics, would typically be determined through experimental methods and could vary based on the conditions under which they are measured. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-7-3-5-9(6-4-7)10-13-11(8(2)12)15-14-10/h3-6,8H,12H2,1-2H3
InChI key:InChIKey=DQVGKSKROOPQQB-UHFFFAOYSA-N
SMILES:C(C)(N)C1=NC(=NO1)C2=CC=C(C)C=C2
Synonyms:
  • 1-(3-(p-Tolyl)-1,2,4-oxadiazol-5-yl)ethanamine
  • 1-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]ethanamine
  • 1-(3-p-Tolyl-[1,2,4]oxadiazol-5-yl)-ethylamine
  • α-Methyl-3-(4-methylphenyl)-1,2,4-oxadiazole-5-methanamine
  • 1,2,4-Oxadiazole-5-methanamine, α-methyl-3-(4-methylphenyl)-
Found 1 products.