CymitQuimica logo

CAS 915923-54-5

:

2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]benzaldehyde

Description:
2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]benzaldehyde, with the CAS number 915923-54-5, is an organic compound characterized by its complex structure that includes a benzaldehyde moiety and a piperidine derivative. This compound features a benzene ring substituted with an aldehyde group and an ethoxy group linked to a piperidine ring, which contributes to its potential biological activity. The presence of the 4-methylpiperidine group suggests that it may exhibit properties related to neurotransmitter modulation, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents due to its hydrophobic aromatic and piperidine components, while the aldehyde group may participate in various chemical reactions, such as nucleophilic additions. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential reactivity of the aldehyde functional group.
Formula:C15H19NO3
InChI:InChI=1/C15H19NO3/c1-12-6-8-16(9-7-12)15(18)11-19-14-5-3-2-4-13(14)10-17/h2-5,10,12H,6-9,11H2,1H3
InChI key:JHAFTECWLPMWIQ-UHFFFAOYSA-N
SMILES:CC1CCN(CC1)C(=O)COc1ccccc1C=O
Found 2 products.