CAS 91604-41-0
:(+)-1,4-di-O-benzyl-D-threitol
Description:
(+)-1,4-di-O-benzyl-D-threitol is a chiral organic compound characterized by its two benzyl ether groups attached to a D-threitol backbone. This compound is a sugar alcohol derivative, which means it contains multiple hydroxyl (-OH) groups, contributing to its solubility in polar solvents like water. The presence of the benzyl groups enhances its hydrophobic character, making it less soluble in non-polar solvents. As a chiral molecule, it exhibits optical activity, meaning it can rotate plane-polarized light, a property that is significant in various applications, particularly in pharmaceuticals and organic synthesis. The compound is often utilized in the synthesis of more complex molecules and can serve as a building block in carbohydrate chemistry. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the benzyl groups, which can participate in various chemical reactions, including nucleophilic substitutions and reductions.
Formula:C18H22O4
InChI:InChI=1/C18H22O4/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-/m1/s1
SMILES:c1ccc(cc1)COC[C@H]([C@@H](COCc1ccccc1)O)O
Synonyms:- (2R,3R)-(+)-1,4-Dibenzyloxy-2,3-butanediol
- (2R,3R)-1,4-bis(benzyloxy)butane-2,3-diol
- (+)-1,4-Di-O-benzyl-D-threito
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(+)-1,4-Di-O-benzyl-D-threitol
CAS:Formula:C18H22O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:302.37(+)-1,4-Di-O-Benzyl-D-Threitol
CAS:(+)-1,4-Di-O-Benzyl-D-ThreitolFormula:C18H22O4Purity:98%Molecular weight:302.37(2R,3R)-1,4-Bis(benzyloxy)butane-2,3-diol
CAS:Formula:C18H22O4Purity:98%Color and Shape:SolidMolecular weight:302.3649(+)-1,4-Di-O-benzyl-D-threitol
CAS:(+)-1,4-Di-O-benzyl-D-threitol is a carbohydrate which is an enantiomer of D-threitol. It has been used as a model membrane to investigate the interaction of divalent cations with the lipid bilayer. The (+) form of this compound has been shown to be catalytic in the desymmetrization of racemic mixtures of carbohydrates. This enantiomer can be readily chromatographically separated from its mirror image by chiral chromatography techniques.Formula:C18H22O4Purity:Min. 95%Molecular weight:302.36 g/mol





